C10H14F3N3O2 — CID 115491616
6-oxo-N-(5,5,5-trifluoropentyl)-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 115491616) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is 6-oxo-N-(5,5,5-trifluoropentyl)-4,5-dihydro-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-(5,5,5-trifluoropentyl)-4,5-dihydro-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 115491616 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6-oxo-N-(5,5,5-trifluoropentyl)-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)NCCCCC(F)(F)F)=NN1 |
| InChI | InChI=1S/C10H14F3N3O2/c11-10(12,13)5-1-2-6-14-9(18)7-3-4-8(17)16-15-7/h1-6H2,(H,14,18)(H,16,17) |
| InChIKey | DUAGMEDVNHNKJE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|