C11H16F3N3O — CID 115492113
3,5-dimethyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide (PubChem CID 115492113) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 3,5-dimethyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115492113 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3,5-dimethyl-N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O/c1-7-9(8(2)17-16-7)10(18)15-6-4-3-5-11(12,13)14/h3-6H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | YUAQOUUQHMUMSI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|