C16H22N2O — CID 115493082
2-amino-3-(4-butylphenoxy)-2-cyclopropylpropanenitrile (PubChem CID 115493082) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-amino-3-(4-butylphenoxy)-2-cyclopropylpropanenitrile.
| Compound Name | 2-amino-3-(4-butylphenoxy)-2-cyclopropylpropanenitrile |
|---|---|
| PubChem CID | 115493082 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-amino-3-(4-butylphenoxy)-2-cyclopropylpropanenitrile |
| SMILES | CCCCc1ccc(OCC(N)(C#N)C2CC2)cc1 |
| InChI | InChI=1S/C16H22N2O/c1-2-3-4-13-5-9-15(10-6-13)19-12-16(18,11-17)14-7-8-14/h5-6,9-10,14H,2-4,7-8,12,18H2,1H3 |
| InChIKey | PWYOFKLZGNOZSP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |