C31H40N6O7S3 — CID 11549365
tert-butyl (4S,5R)-4-[4-[(3R)-3-amino-3,6-bis(4-ethoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11549365) has the molecular formula C31H40N6O7S3 and a molecular weight of 704.90 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[4-[(3R)-3-amino-3,6-bis(4-ethoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[4-[(3R)-3-amino-3,6-bis(4-ethoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11549365 |
| Molecular Formula | C31H40N6O7S3 |
| Molecular Weight | 704.90 g/mol |
| Exact Mass | 704.21 |
| IUPAC Name | tert-butyl (4S,5R)-4-[4-[(3R)-3-amino-3,6-bis(4-ethoxycarbonyl-1,3-thiazol-2-yl)-4,5-dihydro-2H-pyridin-2-yl]-1,3-thiazol-2-yl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)c1csc(C2=NC(c3csc([C@@H]4[C@@H](C)OC(C)(C)N4C(=O)OC(C)(C)C)n3)[C@@](N)(c3nc(C(=O)OCC)cs3)CC2)n1 |
| InChI | InChI=1S/C31H40N6O7S3/c1-9-41-25(38)19-14-45-23(35-19)17-11-12-31(32,27-36-20(15-47-27)26(39)42-10-2)22(33-17)18-13-46-24(34-18)21-16(3)43-30(7,8)37(21)28(40)44-29(4,5)6/h13-16,21-22H,9-12,32H2,1-8H3/t16-,21+,22?,31-/m1/s1 |
| InChIKey | SCWJBPOVOUKBPT-XXMZNTTOSA-N |
| XLogP | 6.02 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.90 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|