C18H23NO2 — CID 115494162
4-[2-(3-methoxy-2,4-dimethylanilino)propyl]phenol (PubChem CID 115494162) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[2-(3-methoxy-2,4-dimethylanilino)propyl]phenol.
| Compound Name | 4-[2-(3-methoxy-2,4-dimethylanilino)propyl]phenol |
|---|---|
| PubChem CID | 115494162 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-[2-(3-methoxy-2,4-dimethylanilino)propyl]phenol |
| SMILES | COc1c(C)ccc(NC(C)Cc2ccc(O)cc2)c1C |
| InChI | InChI=1S/C18H23NO2/c1-12-5-10-17(14(3)18(12)21-4)19-13(2)11-15-6-8-16(20)9-7-15/h5-10,13,19-20H,11H2,1-4H3 |
| InChIKey | BEFDAZCLMZWINQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |