C24H29N5O3S — CID 1154945
2-[[5-[(4-methoxyanilino)methyl]-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone (PubChem CID 1154945) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[[5-[(4-methoxyanilino)methyl]-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[[5-[(4-methoxyanilino)methyl]-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 1154945 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[[5-[(4-methoxyanilino)methyl]-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-piperidin-1-ylethanone |
| SMILES | COc1ccc(NCc2nnc(SCC(=O)N3CCCCC3)n2-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C24H29N5O3S/c1-31-19-12-10-18(11-13-19)25-16-22-26-27-24(29(22)20-8-4-5-9-21(20)32-2)33-17-23(30)28-14-6-3-7-15-28/h4-5,8-13,25H,3,6-7,14-17H2,1-2H3 |
| InChIKey | HMMGYIWKZGUKDF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|