C19H22O2 — CID 115495303
1-[4-[(2,4,6-trimethylphenyl)methoxy]phenyl]propan-2-one (PubChem CID 115495303) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[4-[(2,4,6-trimethylphenyl)methoxy]phenyl]propan-2-one.
| Compound Name | 1-[4-[(2,4,6-trimethylphenyl)methoxy]phenyl]propan-2-one |
|---|---|
| PubChem CID | 115495303 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-[4-[(2,4,6-trimethylphenyl)methoxy]phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(OCc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H22O2/c1-13-9-14(2)19(15(3)10-13)12-21-18-7-5-17(6-8-18)11-16(4)20/h5-10H,11-12H2,1-4H3 |
| InChIKey | KGRAYTBNJYCHDR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |