About [4-(2-oxopropyl)phenyl] carbonochloridate
[4-(2-oxopropyl)phenyl] carbonochloridate (PubChem CID 115496228) has the molecular formula C10H9ClO3
and a molecular weight of 212.63 g/mol. Its IUPAC name is [4-(2-oxopropyl)phenyl] carbonochloridate.
Molecular Properties
| Compound Name | [4-(2-oxopropyl)phenyl] carbonochloridate |
| PubChem CID | 115496228 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | [4-(2-oxopropyl)phenyl] carbonochloridate |
| SMILES | CC(=O)Cc1ccc(OC(=O)Cl)cc1 |
| InChI | InChI=1S/C10H9ClO3/c1-7(12)6-8-2-4-9(5-3-8)14-10(11)13/h2-5H,6H2,1H3 |
| InChIKey | WHWJUCFVGLXXKM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-oxopropyl)phenyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-oxopropyl)phenyl] carbonochloridate?
The IUPAC name of [4-(2-oxopropyl)phenyl] carbonochloridate (CID 115496228) is [4-(2-oxopropyl)phenyl] carbonochloridate.
What is the SMILES notation for [4-(2-oxopropyl)phenyl] carbonochloridate?
The canonical SMILES for [4-(2-oxopropyl)phenyl] carbonochloridate is CC(=O)Cc1ccc(OC(=O)Cl)cc1.
What is the InChIKey of [4-(2-oxopropyl)phenyl] carbonochloridate?
The InChIKey is WHWJUCFVGLXXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO3/c1-7(12)6-8-2-4-9(5-3-8)14-10(11)13/h2-5H,6H2,1H3.
What are the key properties of [4-(2-oxopropyl)phenyl] carbonochloridate?
[4-(2-oxopropyl)phenyl] carbonochloridate has a molecular weight of 212.63 g/mol, XLogP of 2.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-oxopropyl)phenyl] carbonochloridate is sourced from PubChem (CID 115496228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).