About 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol
1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol (PubChem CID 115496242) has the molecular formula C12H22F3NO
and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol |
| PubChem CID | 115496242 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1(CNCCCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C12H22F3NO/c13-12(14,15)8-4-5-9-16-10-11(17)6-2-1-3-7-11/h16-17H,1-10H2 |
| InChIKey | WUYGMKWCYAJUHQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol?
The IUPAC name of 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol (CID 115496242) is 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol?
The canonical SMILES for 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol is OC1(CNCCCCC(F)(F)F)CCCCC1.
What is the InChIKey of 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol?
The InChIKey is WUYGMKWCYAJUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO/c13-12(14,15)8-4-5-9-16-10-11(17)6-2-1-3-7-11/h16-17H,1-10H2.
What are the key properties of 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol?
1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol has a molecular weight of 253.31 g/mol, XLogP of 3.00, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,5,5-trifluoropentylamino)methyl]cyclohexan-1-ol is sourced from PubChem (CID 115496242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).