C12H10FN3O3S — CID 115496429
2-[[(6-fluoropyridine-2-carbonyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 115496429) has the molecular formula C12H10FN3O3S and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[[(6-fluoropyridine-2-carbonyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[(6-fluoropyridine-2-carbonyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115496429 |
| Molecular Formula | C12H10FN3O3S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-[[(6-fluoropyridine-2-carbonyl)amino]methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(CNC(=O)c2cccc(F)n2)sc1C(=O)O |
| InChI | InChI=1S/C12H10FN3O3S/c1-6-10(12(18)19)20-9(15-6)5-14-11(17)7-3-2-4-8(13)16-7/h2-4H,5H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | PIJAKENSAYKJRQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|