C11H11FN4O — CID 115497664
6-fluoro-N-(2-imidazol-1-ylethyl)pyridine-2-carboxamide (PubChem CID 115497664) has the molecular formula C11H11FN4O and a molecular weight of 234.23 g/mol. Its IUPAC name is 6-fluoro-N-(2-imidazol-1-ylethyl)pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-(2-imidazol-1-ylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497664 |
| Molecular Formula | C11H11FN4O |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-fluoro-N-(2-imidazol-1-ylethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCn1ccnc1)c1cccc(F)n1 |
| InChI | InChI=1S/C11H11FN4O/c12-10-3-1-2-9(15-10)11(17)14-5-7-16-6-4-13-8-16/h1-4,6,8H,5,7H2,(H,14,17) |
| InChIKey | GMIGJHCHWKKDKO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|