C14H18N4O2 — CID 115500165
5-[(1-ethylpyrrolidin-3-yl)methylamino]-2-nitrobenzonitrile (PubChem CID 115500165) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[(1-ethylpyrrolidin-3-yl)methylamino]-2-nitrobenzonitrile.
| Compound Name | 5-[(1-ethylpyrrolidin-3-yl)methylamino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115500165 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-[(1-ethylpyrrolidin-3-yl)methylamino]-2-nitrobenzonitrile |
| SMILES | CCN1CCC(CNc2ccc([N+](=O)[O-])c(C#N)c2)C1 |
| InChI | InChI=1S/C14H18N4O2/c1-2-17-6-5-11(10-17)9-16-13-3-4-14(18(19)20)12(7-13)8-15/h3-4,7,11,16H,2,5-6,9-10H2,1H3 |
| InChIKey | IGXQAKTVUWESAS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|