C7H15NO2 — CID 11550031
(3S,4S)-5,5-dimethylpiperidine-3,4-diol (PubChem CID 11550031) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (3S,4S)-5,5-dimethylpiperidine-3,4-diol.
| Compound Name | (3S,4S)-5,5-dimethylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 11550031 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (3S,4S)-5,5-dimethylpiperidine-3,4-diol |
| SMILES | CC1(C)CNC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H15NO2/c1-7(2)4-8-3-5(9)6(7)10/h5-6,8-10H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | GHFPKMWUROLART-NTSWFWBYSA-N |
| XLogP | -0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |