methyl (2R)-3-carbamoyloxy-2-methylpropanoate

C6H11NO4 — CID 11550055

IUPACmethyl (2R)-3-carbamoyloxy-2-methylpropanoate
SMILESCOC(=O)[C@H](C)COC(N)=O
InChIInChI=1S/C6H11NO4/c1-4(5(8)10-2)3-11-6(7)9/h4H,3H2,1-2H3,(H2,7,9)/t4-/m1/s1
InChIKeyBCLAWZYTKGRTKV-SCSAIBSYSA-N
MW161.16 g/mol
LogP-0.11
Rot. Bonds3

About methyl (2R)-3-carbamoyloxy-2-methylpropanoate

methyl (2R)-3-carbamoyloxy-2-methylpropanoate (PubChem CID 11550055) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is methyl (2R)-3-carbamoyloxy-2-methylpropanoate.

Molecular Properties

Compound Namemethyl (2R)-3-carbamoyloxy-2-methylpropanoate
PubChem CID11550055
Molecular FormulaC6H11NO4
Molecular Weight161.16 g/mol
Exact Mass161.07
IUPAC Namemethyl (2R)-3-carbamoyloxy-2-methylpropanoate
SMILESCOC(=O)[C@H](C)COC(N)=O
InChIInChI=1S/C6H11NO4/c1-4(5(8)10-2)3-11-6(7)9/h4H,3H2,1-2H3,(H2,7,9)/t4-/m1/s1
InChIKeyBCLAWZYTKGRTKV-SCSAIBSYSA-N
XLogP-0.11
TPSA78.62 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 5-0.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2R)-3-carbamoyloxy-2-methylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-3-carbamoyloxy-2-methylpropanoate?
The IUPAC name of methyl (2R)-3-carbamoyloxy-2-methylpropanoate (CID 11550055) is methyl (2R)-3-carbamoyloxy-2-methylpropanoate.
What is the SMILES notation for methyl (2R)-3-carbamoyloxy-2-methylpropanoate?
The canonical SMILES for methyl (2R)-3-carbamoyloxy-2-methylpropanoate is COC(=O)[C@H](C)COC(N)=O.
What is the InChIKey of methyl (2R)-3-carbamoyloxy-2-methylpropanoate?
The InChIKey is BCLAWZYTKGRTKV-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H11NO4/c1-4(5(8)10-2)3-11-6(7)9/h4H,3H2,1-2H3,(H2,7,9)/t4-/m1/s1.
What are the key properties of methyl (2R)-3-carbamoyloxy-2-methylpropanoate?
methyl (2R)-3-carbamoyloxy-2-methylpropanoate has a molecular weight of 161.16 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3-carbamoyloxy-2-methylpropanoate is sourced from PubChem (CID 11550055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).