C13H6F3N3O2 — CID 115500839
5-nitro-2-(2,3,4-trifluoroanilino)benzonitrile (PubChem CID 115500839) has the molecular formula C13H6F3N3O2 and a molecular weight of 293.20 g/mol. Its IUPAC name is 5-nitro-2-(2,3,4-trifluoroanilino)benzonitrile.
| Compound Name | 5-nitro-2-(2,3,4-trifluoroanilino)benzonitrile |
|---|---|
| PubChem CID | 115500839 |
| Molecular Formula | C13H6F3N3O2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-nitro-2-(2,3,4-trifluoroanilino)benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H6F3N3O2/c14-9-2-4-11(13(16)12(9)15)18-10-3-1-8(19(20)21)5-7(10)6-17/h1-5,18H |
| InChIKey | LLFUOUKHSPLCSE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|