C13H13ClF3N3O — CID 115502224
2-[2-(2-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propanamide (PubChem CID 115502224) has the molecular formula C13H13ClF3N3O and a molecular weight of 319.71 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propanamide.
| Compound Name | 2-[2-(2-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propanamide |
|---|---|
| PubChem CID | 115502224 |
| Molecular Formula | C13H13ClF3N3O |
| Molecular Weight | 319.71 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[2-(2-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]propanamide |
| SMILES | CC(C(N)=O)n1c(CCCl)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H13ClF3N3O/c1-7(12(18)21)20-10-3-2-8(13(15,16)17)6-9(10)19-11(20)4-5-14/h2-3,6-7H,4-5H2,1H3,(H2,18,21) |
| InChIKey | VOHGJJFAEGWKMY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|