About 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea
3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea (PubChem CID 11550311) has the molecular formula C9H20N2O4
and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea |
| PubChem CID | 11550311 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea |
| SMILES | CC(O)CN(CC(C)O)C(=O)NCCO |
| InChI | InChI=1S/C9H20N2O4/c1-7(13)5-11(6-8(2)14)9(15)10-3-4-12/h7-8,12-14H,3-6H2,1-2H3,(H,10,15) |
| InChIKey | AWNNECGZCPBURJ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea?
The IUPAC name of 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea (CID 11550311) is 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea.
What is the SMILES notation for 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea?
The canonical SMILES for 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea is CC(O)CN(CC(C)O)C(=O)NCCO.
What is the InChIKey of 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea?
The InChIKey is AWNNECGZCPBURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O4/c1-7(13)5-11(6-8(2)14)9(15)10-3-4-12/h7-8,12-14H,3-6H2,1-2H3,(H,10,15).
What are the key properties of 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea?
3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea has a molecular weight of 220.27 g/mol, XLogP of -1.25, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)-1,1-bis(2-hydroxypropyl)urea is sourced from PubChem (CID 11550311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).