C17H22ClN3 — CID 115504286
6-(3-chloro-4-methylphenyl)-N,5-dipropylpyrimidin-4-amine (PubChem CID 115504286) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 6-(3-chloro-4-methylphenyl)-N,5-dipropylpyrimidin-4-amine.
| Compound Name | 6-(3-chloro-4-methylphenyl)-N,5-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115504286 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 6-(3-chloro-4-methylphenyl)-N,5-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(-c2ccc(C)c(Cl)c2)c1CCC |
| InChI | InChI=1S/C17H22ClN3/c1-4-6-14-16(13-8-7-12(3)15(18)10-13)20-11-21-17(14)19-9-5-2/h7-8,10-11H,4-6,9H2,1-3H3,(H,19,20,21) |
| InChIKey | YEDPZPJYJFFPKJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |