About N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine
N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 11550535) has the molecular formula C16H13N3
and a molecular weight of 247.30 g/mol. Its IUPAC name is N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
Molecular Properties
| Compound Name | N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| PubChem CID | 11550535 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | c1ccc(Nc2n[nH]c3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C16H13N3/c1-2-7-12(8-3-1)17-16-14-10-11-6-4-5-9-13(11)15(14)18-19-16/h1-9H,10H2,(H2,17,18,19) |
| InChIKey | HXUODZKNCJWKGP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The IUPAC name of N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (CID 11550535) is N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
What is the SMILES notation for N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The canonical SMILES for N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine is c1ccc(Nc2n[nH]c3c2Cc2ccccc2-3)cc1.
What is the InChIKey of N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
The InChIKey is HXUODZKNCJWKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3/c1-2-7-12(8-3-1)17-16-14-10-11-6-4-5-9-13(11)15(14)18-19-16/h1-9H,10H2,(H2,17,18,19).
What are the key properties of N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine?
N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine has a molecular weight of 247.30 g/mol, XLogP of 3.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine is sourced from PubChem (CID 11550535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).