C14H24N4O2 — CID 115505405
5-amino-2-[2-[di(propan-2-yl)amino]ethoxy]pyridine-3-carboxamide (PubChem CID 115505405) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-amino-2-[2-[di(propan-2-yl)amino]ethoxy]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-[2-[di(propan-2-yl)amino]ethoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115505405 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 5-amino-2-[2-[di(propan-2-yl)amino]ethoxy]pyridine-3-carboxamide |
| SMILES | CC(C)N(CCOc1ncc(N)cc1C(N)=O)C(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-9(2)18(10(3)4)5-6-20-14-12(13(16)19)7-11(15)8-17-14/h7-10H,5-6,15H2,1-4H3,(H2,16,19) |
| InChIKey | JXJLMVAUGJHURR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |