About 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide
5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 115505568) has the molecular formula C14H27N5O2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 115505568 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | Cc1nn(C)c(OCCN(C(C)C)C(C)C)c1C(N)=NO |
| InChI | InChI=1S/C14H27N5O2/c1-9(2)19(10(3)4)7-8-21-14-12(13(15)17-20)11(5)16-18(14)6/h9-10,20H,7-8H2,1-6H3,(H2,15,17) |
| InChIKey | DYCRSJLXBQSXFE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide (CID 115505568) is 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide is Cc1nn(C)c(OCCN(C(C)C)C(C)C)c1C(N)=NO.
What is the InChIKey of 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
The InChIKey is DYCRSJLXBQSXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5O2/c1-9(2)19(10(3)4)7-8-21-14-12(13(15)17-20)11(5)16-18(14)6/h9-10,20H,7-8H2,1-6H3,(H2,15,17).
What are the key properties of 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide?
5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide has a molecular weight of 297.40 g/mol, XLogP of 1.32, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[di(propan-2-yl)amino]ethoxy]-N'-hydroxy-1,3-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 115505568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).