C14H26N4OS — CID 115505931
6-[2-[di(propan-2-yl)amino]ethoxy]-N-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 115505931) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 6-[2-[di(propan-2-yl)amino]ethoxy]-N-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-[2-[di(propan-2-yl)amino]ethoxy]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115505931 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 6-[2-[di(propan-2-yl)amino]ethoxy]-N-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNc1cc(OCCN(C(C)C)C(C)C)nc(SC)n1 |
| InChI | InChI=1S/C14H26N4OS/c1-10(2)18(11(3)4)7-8-19-13-9-12(15-5)16-14(17-13)20-6/h9-11H,7-8H2,1-6H3,(H,15,16,17) |
| InChIKey | IDPZSMRMDMJBCR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |