C15H10O4 — CID 11550599
4-hydroxy-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,13-pentaene-2,9-dione (PubChem CID 11550599) has the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. Its IUPAC name is 4-hydroxy-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,13-pentaene-2,9-dione.
| Compound Name | 4-hydroxy-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,13-pentaene-2,9-dione |
|---|---|
| PubChem CID | 11550599 |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-hydroxy-16-oxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3(8),4,6,13-pentaene-2,9-dione |
| SMILES | O=C1C2=C(OC3C=CCC23)C(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C15H10O4/c16-9-5-1-4-8-11(9)14(18)15-12(13(8)17)7-3-2-6-10(7)19-15/h1-2,4-7,10,16H,3H2 |
| InChIKey | BVRSZVVYWDJYGL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|