C16H30N4O — CID 115506001
4-[2-[di(propan-2-yl)amino]ethoxy]-5-methyl-N-propylpyrimidin-2-amine (PubChem CID 115506001) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-[2-[di(propan-2-yl)amino]ethoxy]-5-methyl-N-propylpyrimidin-2-amine.
| Compound Name | 4-[2-[di(propan-2-yl)amino]ethoxy]-5-methyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 115506001 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 4-[2-[di(propan-2-yl)amino]ethoxy]-5-methyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(C)c(OCCN(C(C)C)C(C)C)n1 |
| InChI | InChI=1S/C16H30N4O/c1-7-8-17-16-18-11-14(6)15(19-16)21-10-9-20(12(2)3)13(4)5/h11-13H,7-10H2,1-6H3,(H,17,18,19) |
| InChIKey | QOVRXVDJHKZKIF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |