C17H16BrNOS — CID 115506218
1-(3-bromothiophen-2-yl)-2-(7-methoxynaphthalen-1-yl)ethanamine (PubChem CID 115506218) has the molecular formula C17H16BrNOS and a molecular weight of 362.29 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-(7-methoxynaphthalen-1-yl)ethanamine.
| Compound Name | 1-(3-bromothiophen-2-yl)-2-(7-methoxynaphthalen-1-yl)ethanamine |
|---|---|
| PubChem CID | 115506218 |
| Molecular Formula | C17H16BrNOS |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-(7-methoxynaphthalen-1-yl)ethanamine |
| SMILES | COc1ccc2cccc(CC(N)c3sccc3Br)c2c1 |
| InChI | InChI=1S/C17H16BrNOS/c1-20-13-6-5-11-3-2-4-12(14(11)10-13)9-16(19)17-15(18)7-8-21-17/h2-8,10,16H,9,19H2,1H3 |
| InChIKey | IOJUMNSUACHRCW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |