About (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile
(2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile (PubChem CID 11550675) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile |
| PubChem CID | 11550675 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile |
| SMILES | CC1(NCC(=O)N2[C@H](C#N)CC[C@@H]2C#N)CCCC1 |
| InChI | InChI=1S/C14H20N4O/c1-14(6-2-3-7-14)17-10-13(19)18-11(8-15)4-5-12(18)9-16/h11-12,17H,2-7,10H2,1H3/t11-,12+ |
| InChIKey | UKVYWLXLQBSWDK-TXEJJXNPSA-N |
| XLogP | 1.32 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile?
The IUPAC name of (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile (CID 11550675) is (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile.
What is the SMILES notation for (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile?
The canonical SMILES for (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile is CC1(NCC(=O)N2[C@H](C#N)CC[C@@H]2C#N)CCCC1.
What is the InChIKey of (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile?
The InChIKey is UKVYWLXLQBSWDK-TXEJJXNPSA-N. The full InChI is InChI=1S/C14H20N4O/c1-14(6-2-3-7-14)17-10-13(19)18-11(8-15)4-5-12(18)9-16/h11-12,17H,2-7,10H2,1H3/t11-,12+.
What are the key properties of (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile?
(2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile has a molecular weight of 260.34 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-1-[2-[(1-methylcyclopentyl)amino]acetyl]pyrrolidine-2,5-dicarbonitrile is sourced from PubChem (CID 11550675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).