C12H6Cl2F2N4S — CID 115507082
1-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3,5-difluorobenzene-1,2-diamine (PubChem CID 115507082) has the molecular formula C12H6Cl2F2N4S and a molecular weight of 347.18 g/mol. Its IUPAC name is 1-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3,5-difluorobenzene-1,2-diamine.
| Compound Name | 1-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3,5-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115507082 |
| Molecular Formula | C12H6Cl2F2N4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 1-N-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-3,5-difluorobenzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C12H6Cl2F2N4S/c13-5-3-6(14)11-12(20-21-19-11)10(5)18-8-2-4(15)1-7(16)9(8)17/h1-3,18H,17H2 |
| InChIKey | LDNBDLVUGFTHKL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|