About 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine
2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine (PubChem CID 11550747) has the molecular formula C11H10F2N4S
and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine.
Molecular Properties
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine |
| PubChem CID | 11550747 |
| Molecular Formula | C11H10F2N4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine |
| SMILES | FC(F)=CCCSc1nccc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H10F2N4S/c12-9(13)3-1-8-18-11-14-6-4-10(16-11)17-7-2-5-15-17/h2-7H,1,8H2 |
| InChIKey | VEKKCCPFKCNHDQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine?
The IUPAC name of 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine (CID 11550747) is 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine.
What is the SMILES notation for 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine?
The canonical SMILES for 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine is FC(F)=CCCSc1nccc(-n2cccn2)n1.
What is the InChIKey of 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine?
The InChIKey is VEKKCCPFKCNHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N4S/c12-9(13)3-1-8-18-11-14-6-4-10(16-11)17-7-2-5-15-17/h2-7H,1,8H2.
What are the key properties of 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine?
2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine has a molecular weight of 268.29 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorobut-3-enylsulfanyl)-4-pyrazol-1-ylpyrimidine is sourced from PubChem (CID 11550747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).