C15H17F2N3S — CID 115508275
3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5,7-difluoro-1H-benzimidazole-2-thione (PubChem CID 115508275) has the molecular formula C15H17F2N3S and a molecular weight of 309.38 g/mol. Its IUPAC name is 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5,7-difluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5,7-difluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115508275 |
| Molecular Formula | C15H17F2N3S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-5,7-difluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1cc(F)c2[nH]c(=S)n(C3CCN4CCCCC34)c2c1 |
| InChI | InChI=1S/C15H17F2N3S/c16-9-7-10(17)14-13(8-9)20(15(21)18-14)12-4-6-19-5-2-1-3-11(12)19/h7-8,11-12H,1-6H2,(H,18,21) |
| InChIKey | JOISTXVSJGENIU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|