C14H16F2N2O2S — CID 115508515
2-(4,6-difluoro-1-pentan-3-ylbenzimidazol-2-yl)sulfanylacetic acid (PubChem CID 115508515) has the molecular formula C14H16F2N2O2S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-(4,6-difluoro-1-pentan-3-ylbenzimidazol-2-yl)sulfanylacetic acid.
| Compound Name | 2-(4,6-difluoro-1-pentan-3-ylbenzimidazol-2-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 115508515 |
| Molecular Formula | C14H16F2N2O2S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(4,6-difluoro-1-pentan-3-ylbenzimidazol-2-yl)sulfanylacetic acid |
| SMILES | CCC(CC)n1c(SCC(=O)O)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H16F2N2O2S/c1-3-9(4-2)18-11-6-8(15)5-10(16)13(11)17-14(18)21-7-12(19)20/h5-6,9H,3-4,7H2,1-2H3,(H,19,20) |
| InChIKey | JNHXFOHZMIEAOS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |