About (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol
(2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol (PubChem CID 11551021) has the molecular formula C16H23N3O2
and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol |
| PubChem CID | 11551021 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol |
| SMILES | Cc1ccc(C)n1-c1ccc(C(O)CN[C@@H](C)CO)cn1 |
| InChI | InChI=1S/C16H23N3O2/c1-11(10-20)17-9-15(21)14-6-7-16(18-8-14)19-12(2)4-5-13(19)3/h4-8,11,15,17,20-21H,9-10H2,1-3H3/t11-,15?/m0/s1 |
| InChIKey | ARMRUYCLGGELRB-VPHXOMNUSA-N |
| XLogP | 1.49 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol?
The IUPAC name of (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol (CID 11551021) is (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol.
What is the SMILES notation for (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol?
The canonical SMILES for (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol is Cc1ccc(C)n1-c1ccc(C(O)CN[C@@H](C)CO)cn1.
What is the InChIKey of (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol?
The InChIKey is ARMRUYCLGGELRB-VPHXOMNUSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-11(10-20)17-9-15(21)14-6-7-16(18-8-14)19-12(2)4-5-13(19)3/h4-8,11,15,17,20-21H,9-10H2,1-3H3/t11-,15?/m0/s1.
What are the key properties of (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol?
(2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol has a molecular weight of 289.38 g/mol, XLogP of 1.49, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[2-[6-(2,5-dimethylpyrrol-1-yl)-3-pyridinyl]-2-hydroxyethyl]amino]propan-1-ol is sourced from PubChem (CID 11551021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).