C17H25NO3 — CID 115510557
ethyl 4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butanoate (PubChem CID 115510557) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is ethyl 4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butanoate.
| Compound Name | ethyl 4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butanoate |
|---|---|
| PubChem CID | 115510557 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | ethyl 4-[(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC1CCc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C17H25NO3/c1-3-21-17(19)5-4-10-18-15-8-6-13-7-9-16(20-2)12-14(13)11-15/h7,9,12,15,18H,3-6,8,10-11H2,1-2H3 |
| InChIKey | GWDMXHSRCJNERN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|