4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid

C16H10FN3O2 — CID 11551078

IUPAC4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid
SMILESO=C(O)c1ccc(-c2ncnc(-c3ccc(F)cc3)n2)cc1
InChIInChI=1S/C16H10FN3O2/c17-13-7-5-11(6-8-13)15-19-9-18-14(20-15)10-1-3-12(4-2-10)16(21)22/h1-9H,(H,21,22)
InChIKeyJMBCUYINJOBJNO-UHFFFAOYSA-N
MW295.27 g/mol
LogP3.04
Rot. Bonds3

About 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid

4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid (PubChem CID 11551078) has the molecular formula C16H10FN3O2 and a molecular weight of 295.27 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid.

Molecular Properties

Compound Name4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid
PubChem CID11551078
Molecular FormulaC16H10FN3O2
Molecular Weight295.27 g/mol
Exact Mass295.08
IUPAC Name4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid
SMILESO=C(O)c1ccc(-c2ncnc(-c3ccc(F)cc3)n2)cc1
InChIInChI=1S/C16H10FN3O2/c17-13-7-5-11(6-8-13)15-19-9-18-14(20-15)10-1-3-12(4-2-10)16(21)22/h1-9H,(H,21,22)
InChIKeyJMBCUYINJOBJNO-UHFFFAOYSA-N
XLogP3.04
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.27
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid?
The IUPAC name of 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid (CID 11551078) is 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid.
What is the SMILES notation for 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid?
The canonical SMILES for 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid is O=C(O)c1ccc(-c2ncnc(-c3ccc(F)cc3)n2)cc1.
What is the InChIKey of 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid?
The InChIKey is JMBCUYINJOBJNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN3O2/c17-13-7-5-11(6-8-13)15-19-9-18-14(20-15)10-1-3-12(4-2-10)16(21)22/h1-9H,(H,21,22).
What are the key properties of 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid?
4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid has a molecular weight of 295.27 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluorophenyl)-1,3,5-triazin-2-yl]benzoic acid is sourced from PubChem (CID 11551078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).