C14H16O7 — CID 11551092
dimethyl (1R,4S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate (PubChem CID 11551092) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is dimethyl (1R,4S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,4S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11551092 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | dimethyl (1R,4S)-7,7-dimethoxy-8-oxobicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2C=C[C@@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C14H16O7/c1-18-12(16)9-7-5-6-8(10(9)13(17)19-2)14(20-3,21-4)11(7)15/h5-8H,1-4H3/t7-,8+/m0/s1 |
| InChIKey | UICHRSATRQKXJA-JGVFFNPUSA-N |
| XLogP | 0.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|