C15H23NO5 — CID 11551115
(2R,3S,4R,5R)-2-[(4-propylanilino)methyl]oxane-2,3,4,5-tetrol (PubChem CID 11551115) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(4-propylanilino)methyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5R)-2-[(4-propylanilino)methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 11551115 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(4-propylanilino)methyl]oxane-2,3,4,5-tetrol |
| SMILES | CCCc1ccc(NC[C@@]2(O)OC[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H23NO5/c1-2-3-10-4-6-11(7-5-10)16-9-15(20)14(19)13(18)12(17)8-21-15/h4-7,12-14,16-20H,2-3,8-9H2,1H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | NWVYYDQPIAQERZ-APIJFGDWSA-N |
| XLogP | -0.15 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |