About 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline
2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline (PubChem CID 115511804) has the molecular formula C12H13BrF3NO2S
and a molecular weight of 372.21 g/mol. Its IUPAC name is 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline |
| PubChem CID | 115511804 |
| Molecular Formula | C12H13BrF3NO2S |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline |
| SMILES | O=S1(=O)CCCC1CNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H13BrF3NO2S/c13-10-6-8(12(14,15)16)3-4-11(10)17-7-9-2-1-5-20(9,18)19/h3-4,6,9,17H,1-2,5,7H2 |
| InChIKey | AWUXIZPIYYKGKZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline?
The IUPAC name of 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline (CID 115511804) is 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline.
What is the SMILES notation for 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline?
The canonical SMILES for 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline is O=S1(=O)CCCC1CNc1ccc(C(F)(F)F)cc1Br.
What is the InChIKey of 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline?
The InChIKey is AWUXIZPIYYKGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF3NO2S/c13-10-6-8(12(14,15)16)3-4-11(10)17-7-9-2-1-5-20(9,18)19/h3-4,6,9,17H,1-2,5,7H2.
What are the key properties of 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline?
2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline has a molecular weight of 372.21 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(1,1-dioxothiolan-2-yl)methyl]-4-(trifluoromethyl)aniline is sourced from PubChem (CID 115511804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).