C14H16BrF3N2 — CID 115511950
5-[2-bromo-4-(trifluoromethyl)phenyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 115511950) has the molecular formula C14H16BrF3N2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 5-[2-bromo-4-(trifluoromethyl)phenyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[2-bromo-4-(trifluoromethyl)phenyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 115511950 |
| Molecular Formula | C14H16BrF3N2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 5-[2-bromo-4-(trifluoromethyl)phenyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1c1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C14H16BrF3N2/c1-8-11-6-19-5-9(11)7-20(8)13-3-2-10(4-12(13)15)14(16,17)18/h2-4,8-9,11,19H,5-7H2,1H3 |
| InChIKey | WFWLDUCZQWLFMW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |