About (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione
(5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11551198) has the molecular formula C15H11NO4S
and a molecular weight of 301.32 g/mol. Its IUPAC name is (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| PubChem CID | 11551198 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(O)c(-c2ccc(/C=C3\SC(=O)NC3=O)o2)c1 |
| InChI | InChI=1S/C15H11NO4S/c1-8-2-4-11(17)10(6-8)12-5-3-9(20-12)7-13-14(18)16-15(19)21-13/h2-7,17H,1H3,(H,16,18,19)/b13-7- |
| InChIKey | CMZIHVRMPLWUAZ-QPEQYQDCSA-N |
| XLogP | 3.28 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione?
The IUPAC name of (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (CID 11551198) is (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione?
The canonical SMILES for (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione is Cc1ccc(O)c(-c2ccc(/C=C3\SC(=O)NC3=O)o2)c1.
What is the InChIKey of (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione?
The InChIKey is CMZIHVRMPLWUAZ-QPEQYQDCSA-N. The full InChI is InChI=1S/C15H11NO4S/c1-8-2-4-11(17)10(6-8)12-5-3-9(20-12)7-13-14(18)16-15(19)21-13/h2-7,17H,1H3,(H,16,18,19)/b13-7-.
What are the key properties of (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione?
(5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione has a molecular weight of 301.32 g/mol, XLogP of 3.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[[5-(2-hydroxy-5-methylphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 11551198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).