C18H28N2O2 — CID 11551248
2-(1-adamantyl)-N-[(3S)-2-oxoazepan-3-yl]acetamide (PubChem CID 11551248) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(3S)-2-oxoazepan-3-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(3S)-2-oxoazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 11551248 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-(1-adamantyl)-N-[(3S)-2-oxoazepan-3-yl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C18H28N2O2/c21-16(20-15-3-1-2-4-19-17(15)22)11-18-8-12-5-13(9-18)7-14(6-12)10-18/h12-15H,1-11H2,(H,19,22)(H,20,21)/t12?,13?,14?,15-,18?/m0/s1 |
| InChIKey | KFAALOQUGLRPEW-URZJAHPPSA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |