C10H9ClN2O — CID 115512659
1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one (PubChem CID 115512659) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one.
| Compound Name | 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 115512659 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)propan-1-one |
| SMILES | CCC(=O)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C10H9ClN2O/c1-2-8(14)6-5-13-10-9(6)7(11)3-4-12-10/h3-5H,2H2,1H3,(H,12,13) |
| InChIKey | OITRCRZVTBVACG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |