C10H8Cl2F3N3S — CID 115513763
3,5-dichloro-N-(4,4,4-trifluorobutyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 115513763) has the molecular formula C10H8Cl2F3N3S and a molecular weight of 330.16 g/mol. Its IUPAC name is 3,5-dichloro-N-(4,4,4-trifluorobutyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(4,4,4-trifluorobutyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 115513763 |
| Molecular Formula | C10H8Cl2F3N3S |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 3,5-dichloro-N-(4,4,4-trifluorobutyl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | FC(F)(F)CCCNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C10H8Cl2F3N3S/c11-5-4-6(12)8-9(18-19-17-8)7(5)16-3-1-2-10(13,14)15/h4,16H,1-3H2 |
| InChIKey | AVNJOBGWGGOODU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|