About 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one
1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one (PubChem CID 115513903) has the molecular formula C13H16F3N3O
and a molecular weight of 287.28 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one |
| PubChem CID | 115513903 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one |
| SMILES | Nc1ccccc1N1CCN(CCCC(F)(F)F)C1=O |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)6-3-7-18-8-9-19(12(18)20)11-5-2-1-4-10(11)17/h1-2,4-5H,3,6-9,17H2 |
| InChIKey | GDXFQGYCBFCFIU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one?
The IUPAC name of 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one (CID 115513903) is 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one.
What is the SMILES notation for 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one?
The canonical SMILES for 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one is Nc1ccccc1N1CCN(CCCC(F)(F)F)C1=O.
What is the InChIKey of 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one?
The InChIKey is GDXFQGYCBFCFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N3O/c14-13(15,16)6-3-7-18-8-9-19(12(18)20)11-5-2-1-4-10(11)17/h1-2,4-5H,3,6-9,17H2.
What are the key properties of 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one?
1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one has a molecular weight of 287.28 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminophenyl)-3-(4,4,4-trifluorobutyl)imidazolidin-2-one is sourced from PubChem (CID 115513903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).