About 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide
2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide (PubChem CID 115513947) has the molecular formula C9H17F3N2S
and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide.
Molecular Properties
| Compound Name | 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide |
| PubChem CID | 115513947 |
| Molecular Formula | C9H17F3N2S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide |
| SMILES | CCCN(CCCC(F)(F)F)CC(N)=S |
| InChI | InChI=1S/C9H17F3N2S/c1-2-5-14(7-8(13)15)6-3-4-9(10,11)12/h2-7H2,1H3,(H2,13,15) |
| InChIKey | NLYAXTMMMQXBAZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide?
The IUPAC name of 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide (CID 115513947) is 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide.
What is the SMILES notation for 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide?
The canonical SMILES for 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide is CCCN(CCCC(F)(F)F)CC(N)=S.
What is the InChIKey of 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide?
The InChIKey is NLYAXTMMMQXBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2S/c1-2-5-14(7-8(13)15)6-3-4-9(10,11)12/h2-7H2,1H3,(H2,13,15).
What are the key properties of 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide?
2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide has a molecular weight of 242.31 g/mol, XLogP of 2.33, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propyl(4,4,4-trifluorobutyl)amino]ethanethioamide is sourced from PubChem (CID 115513947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).