C9H16F3N3O — CID 115514096
N'-hydroxy-1-(4,4,4-trifluorobutyl)pyrrolidine-2-carboximidamide (PubChem CID 115514096) has the molecular formula C9H16F3N3O and a molecular weight of 239.24 g/mol. Its IUPAC name is N'-hydroxy-1-(4,4,4-trifluorobutyl)pyrrolidine-2-carboximidamide.
| Compound Name | N'-hydroxy-1-(4,4,4-trifluorobutyl)pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 115514096 |
| Molecular Formula | C9H16F3N3O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N'-hydroxy-1-(4,4,4-trifluorobutyl)pyrrolidine-2-carboximidamide |
| SMILES | NC(=NO)C1CCCN1CCCC(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O/c10-9(11,12)4-2-6-15-5-1-3-7(15)8(13)14-16/h7,16H,1-6H2,(H2,13,14) |
| InChIKey | DLYSZQSTCOJUBI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|