C9H15F3N4S — CID 115514170
4-propan-2-yl-5-(4,4,4-trifluorobutylsulfanyl)-1,2,4-triazol-3-amine (PubChem CID 115514170) has the molecular formula C9H15F3N4S and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-propan-2-yl-5-(4,4,4-trifluorobutylsulfanyl)-1,2,4-triazol-3-amine.
| Compound Name | 4-propan-2-yl-5-(4,4,4-trifluorobutylsulfanyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115514170 |
| Molecular Formula | C9H15F3N4S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-propan-2-yl-5-(4,4,4-trifluorobutylsulfanyl)-1,2,4-triazol-3-amine |
| SMILES | CC(C)n1c(N)nnc1SCCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4S/c1-6(2)16-7(13)14-15-8(16)17-5-3-4-9(10,11)12/h6H,3-5H2,1-2H3,(H2,13,14) |
| InChIKey | KSMKPLFTSVQPSA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|