C14H14F3NO2 — CID 115514292
4,7-dimethyl-1-(4,4,4-trifluorobutyl)indole-2,3-dione (PubChem CID 115514292) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 4,7-dimethyl-1-(4,4,4-trifluorobutyl)indole-2,3-dione.
| Compound Name | 4,7-dimethyl-1-(4,4,4-trifluorobutyl)indole-2,3-dione |
|---|---|
| PubChem CID | 115514292 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4,7-dimethyl-1-(4,4,4-trifluorobutyl)indole-2,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)C(=O)N2CCCC(F)(F)F |
| InChI | InChI=1S/C14H14F3NO2/c1-8-4-5-9(2)11-10(8)12(19)13(20)18(11)7-3-6-14(15,16)17/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | GBVPSGVZFLAEDH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|