C14H13F3O5 — CID 11551458
[(2R,4S,5S)-4-acetyloxy-3,3,5-trifluorooxolan-2-yl]methyl benzoate (PubChem CID 11551458) has the molecular formula C14H13F3O5 and a molecular weight of 318.25 g/mol. Its IUPAC name is [(2R,4S,5S)-4-acetyloxy-3,3,5-trifluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4S,5S)-4-acetyloxy-3,3,5-trifluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11551458 |
| Molecular Formula | C14H13F3O5 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [(2R,4S,5S)-4-acetyloxy-3,3,5-trifluorooxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](F)O[C@H](COC(=O)c2ccccc2)C1(F)F |
| InChI | InChI=1S/C14H13F3O5/c1-8(18)21-11-12(15)22-10(14(11,16)17)7-20-13(19)9-5-3-2-4-6-9/h2-6,10-12H,7H2,1H3/t10-,11+,12-/m1/s1 |
| InChIKey | GUAYFAGMKBSQRM-GRYCIOLGSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |