About ethyl 2-cyano-6,6,6-trifluorohexanoate
ethyl 2-cyano-6,6,6-trifluorohexanoate (PubChem CID 115514814) has the molecular formula C9H12F3NO2
and a molecular weight of 223.19 g/mol. Its IUPAC name is ethyl 2-cyano-6,6,6-trifluorohexanoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-6,6,6-trifluorohexanoate |
| PubChem CID | 115514814 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | ethyl 2-cyano-6,6,6-trifluorohexanoate |
| SMILES | CCOC(=O)C(C#N)CCCC(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2/c1-2-15-8(14)7(6-13)4-3-5-9(10,11)12/h7H,2-5H2,1H3 |
| InChIKey | QXZZBZRQUCCPGO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-cyano-6,6,6-trifluorohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-6,6,6-trifluorohexanoate?
The IUPAC name of ethyl 2-cyano-6,6,6-trifluorohexanoate (CID 115514814) is ethyl 2-cyano-6,6,6-trifluorohexanoate.
What is the SMILES notation for ethyl 2-cyano-6,6,6-trifluorohexanoate?
The canonical SMILES for ethyl 2-cyano-6,6,6-trifluorohexanoate is CCOC(=O)C(C#N)CCCC(F)(F)F.
What is the InChIKey of ethyl 2-cyano-6,6,6-trifluorohexanoate?
The InChIKey is QXZZBZRQUCCPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO2/c1-2-15-8(14)7(6-13)4-3-5-9(10,11)12/h7H,2-5H2,1H3.
What are the key properties of ethyl 2-cyano-6,6,6-trifluorohexanoate?
ethyl 2-cyano-6,6,6-trifluorohexanoate has a molecular weight of 223.19 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-6,6,6-trifluorohexanoate is sourced from PubChem (CID 115514814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).