About 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol
4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol (PubChem CID 11551495) has the molecular formula C19H16N2O3
and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol.
Molecular Properties
| Compound Name | 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol |
| PubChem CID | 11551495 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol |
| SMILES | Oc1ccc(-c2cncc(NCc3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C19H16N2O3/c22-17-4-2-14(3-5-17)15-8-16(11-20-10-15)21-9-13-1-6-18-19(7-13)24-12-23-18/h1-8,10-11,21-22H,9,12H2 |
| InChIKey | COMIATJOPUPKPV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol?
The IUPAC name of 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol (CID 11551495) is 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol.
What is the SMILES notation for 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol?
The canonical SMILES for 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol is Oc1ccc(-c2cncc(NCc3ccc4c(c3)OCO4)c2)cc1.
What is the InChIKey of 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol?
The InChIKey is COMIATJOPUPKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3/c22-17-4-2-14(3-5-17)15-8-16(11-20-10-15)21-9-13-1-6-18-19(7-13)24-12-23-18/h1-8,10-11,21-22H,9,12H2.
What are the key properties of 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol?
4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol has a molecular weight of 320.35 g/mol, XLogP of 3.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(1,3-benzodioxol-5-ylmethylamino)-3-pyridinyl]phenol is sourced from PubChem (CID 11551495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).