About cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone
cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone (PubChem CID 115515021) has the molecular formula C12H14F3NO
and a molecular weight of 245.24 g/mol. Its IUPAC name is cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone |
| PubChem CID | 115515021 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone |
| SMILES | O=C(c1ccn(CCCC(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C12H14F3NO/c13-12(14,15)5-1-6-16-7-4-10(8-16)11(17)9-2-3-9/h4,7-9H,1-3,5-6H2 |
| InChIKey | REIXFFWBDGFVLM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone?
The IUPAC name of cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone (CID 115515021) is cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone.
What is the SMILES notation for cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone?
The canonical SMILES for cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone is O=C(c1ccn(CCCC(F)(F)F)c1)C1CC1.
What is the InChIKey of cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone?
The InChIKey is REIXFFWBDGFVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3NO/c13-12(14,15)5-1-6-16-7-4-10(8-16)11(17)9-2-3-9/h4,7-9H,1-3,5-6H2.
What are the key properties of cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone?
cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone has a molecular weight of 245.24 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]methanone is sourced from PubChem (CID 115515021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).